![[ICO]](/icons/blank.gif) | Name | Last modified | Size | Description |
|---|
|
|---|
![[PARENTDIR]](/icons/back.gif) | Parent Directory | | - | |
![[ ]](/icons/layout.gif) | 2022 UN Nothing agreement Plastic_pollution_UNEP_EA.5_Res.14_EPP_EN.pdf | 2024-09-14 11:18 | 107K | |
| 41658-doc-WWF_AUC_Africa_Regional_Plastic_Policy_Report.pdf | 2024-09-15 19:42 | 2.0M | |
| Chapter3_Regulations.pdf | 2024-09-17 15:16 | 18M | |
![[ ]](/icons/unknown.gif) | Chapter3_Regulations.pptx | 2024-09-19 15:13 | 36M | |
| Chemical Recycling CR-Technical-Assessment_June-2020_for-printing.pdf | 2024-09-19 14:18 | 2.0M | |
| China 2023 report sustainability-15-09087.pdf | 2024-09-15 19:07 | 2.5M | |
| Extended Producer Responsibiliy 2017 .pdf | 2024-09-15 11:04 | 1.4M | |
![[TXT]](/icons/text.gif) | LICENSE.txt | 2024-08-08 10:55 | 17K | |
| Mobilizing-Federal-Action-on-Plastic-Pollution-Progress-Principles-and-Priorities-July-2024.pdf | 2024-09-14 11:21 | 1.0M | |
| PlasticsforCarbonSequestration.pptx | 2024-09-19 10:31 | 2.8M | |
| README.txt | 2024-08-08 10:55 | 1.1K | |
| Reckoning with Plastic Waste in the Ocean 2022 Report 26132.pdf | 2024-09-14 11:18 | 8.0M | |
| Regulations.html | 2024-09-20 21:17 | 5.3K | |
![[DIR]](/icons/folder.gif) | assets/ | 2024-08-08 10:25 | - | |
| elements.html | 2024-08-08 10:55 | 16K | |
| generic.html | 2024-08-08 10:55 | 2.7K | |
| images/ | 2024-08-08 10:25 | - | |
|
|---|