![[ICO]](/icons/blank.gif){kind=icon}
![[PARENTDIR]](/icons/back.gif){kind=icon}
![[DIR]](/icons/folder.gif){kind=icon}
![[TXT]](/icons/text.gif){kind=icon}
![[ ]](/icons/layout.gif){kind=icon}
![[ ]](/icons/unknown.gif){kind=icon}
| Name | Last modified | Size | Description |
|---|---|---|---|---|
| Parent Directory | - | ||
| images/ | 2024-11-01 13:34 | - | |
| generic.html | 2024-11-01 13:34 | 2.7K | |
| elements.html | 2024-11-01 13:34 | 16K | |
| assets/ | 2024-11-01 13:34 | - | |
| Review Nature 2022 s41578-021-00407-8.pdf | 2024-11-07 14:19 | 2.6M | |
| README.txt | 2024-11-01 13:34 | 1.1K | |
| R17 - Low Energy Ethylene Low Temp Oxidative Coupling Methane Siluria 2016_compliant.pdf | 2024-11-11 19:22 | 830K | |
| LICENSE.txt | 2024-11-01 13:34 | 17K | |
| BioPlastics.html | 2024-11-20 17:13 | 5.1K | |
| 2023 Fermentation of Syngas 1-s2.0-S0960852423007940-main.pdf | 2024-11-07 14:19 | 3.3M | |
| 2020 PHB synthesis polymers-12-02908.pdf | 2024-11-07 14:19 | 1.3M | |
| 2012 Lignoforce Method J-FOR_Vol2-issue4-ART1-The Lignoforce System.pdf | 2024-11-07 14:19 | 1.3M | |
| 2012 Life Cycle Analyses of PEF c2ee02480b.pdf | 2024-11-07 14:19 | 600K | |
| 9 BioPlastics.pptx | 2024-11-19 11:58 | 33M | |
| 9 BioPlastics.pdf | 2024-11-19 11:58 | 11M | |