![[ICO]](/icons/blank.gif) | Name | Last modified | Size | Description |
|---|
|
|---|
![[PARENTDIR]](/icons/back.gif) | Parent Directory | | - | |
![[ ]](/icons/layout.gif) | 1953-Benoit-J Pol Sc-On the effect of branching and polydispersity on the angular distribution of the light scattered by gaussian coils copy 3.pdf | 2024-03-21 21:02 | 189K | |
| 2000 basis for crazy paper cj2033.pdf | 2024-03-21 21:02 | 221K | |
| Benoit Higgins Rg things star etc copy.pdf | 2024-03-21 21:02 | 327K | |
| Benoit Integral Equation 1957 C R Hebd Seances Acad Sci 245 2244 copy.pdf | 2024-03-21 21:02 | 759K | |
![[ ]](/icons/unknown.gif) | Polymer Physics HW 10 2024.docx | 2024-03-22 08:51 | 22K | |
| Polymer Physics HW 10 2024.pdf | 2024-03-22 08:51 | 126K | |
| Rediculus Paper hammond-et-al-2024-small-angle-neutron-scattering-insights-into-2-ethylhexyl-laurate-a-remarkable-bioester.pdf | 2024-03-21 21:02 | 1.8M | |
| Review Chem Rev 2024 alfano-et-al-2024-molecular-crowding-the-history-and-development-of-a-scientific-paradigm.pdf | 2024-03-21 21:02 | 5.8M | |
| SCNP 2023 robles-hern%C3%A1ndez-et-al-2023-structure-of-single-chain-nanoparticles-under-crowding-conditions-a-random-phase.pdf | 2024-03-21 21:02 | 2.7M | |
| Supporting Information ma3c01333_si_001.pdf | 2024-03-21 21:02 | 379K | |
| tan-et-al-2024-small-angle-neutron-scattering-of-p%28ndi2od-t2%29-solutions-importance-of-network-structure-for-data.pdf | 2024-03-21 21:02 | 4.8M | |
|
|---|