![[ICO]](/icons/blank.gif){kind=icon}
![[PARENTDIR]](/icons/back.gif){kind=icon}
![[ ]](/icons/unknown.gif){kind=icon}
![[ ]](/icons/layout.gif){kind=icon}
![[IMG]](/icons/image2.gif){kind=icon}
| Name | Last modified | Size | Description |
|---|---|---|---|---|
| Parent Directory | - | ||
| ~$lymer Physics HW 6 2022.docx | 2022-02-17 22:34 | 162 | |
| tensile blob and flow with cantilever d1sm01305j.pdf | 2022-02-17 22:34 | 4.4M | |
| bottle brush gels d1sm01575c.pdf | 2022-02-17 22:34 | 2.5M | |
| Polymer Physics HW 6 2022.pdf | 2022-02-17 22:35 | 97K | |
| Polymer Physics HW 6 2022.docx | 2022-02-17 22:34 | 21K | |
| Higgins supplemental ma1c02030_si_001.pdf | 2022-02-17 22:34 | 496K | |
| Higgins dilute good to poor solvent.png | 2022-02-17 22:34 | 735K | |
| Higgins blob paper acs.macromol.1c02030.pdf | 2022-02-17 22:34 | 4.6M | |
| Grosberg tensile blob 2202.00239.pdf | 2022-02-17 22:34 | 1.2M | |
| Digitized HW 6.pxp | 2022-02-17 22:34 | 44M | |