![[ICO]](/icons/blank.gif){kind=icon}
![[PARENTDIR]](/icons/back.gif){kind=icon}
![[ ]](/icons/layout.gif){kind=icon}
| Name | Last modified | Size | Description |
|---|---|---|---|---|
| Parent Directory | - | ||
| Table of Contents.pdf | 2024-08-08 10:16 | 75K | |
| Preface.pdf | 2024-08-08 10:16 | 86K | |
| Index.pdf | 2024-08-08 10:16 | 94K | |
| Front Matter.pdf | 2024-08-08 10:16 | 263K | |
| 11. Economic Evaluation and Trends.pdf | 2024-08-08 10:16 | 290K | |
| 10. Legislation and Regulatory Framework.pdf | 2024-08-08 10:16 | 211K | |
| 9. Chemical Recycling.pdf | 2024-08-08 10:16 | 292K | |
| 8. Post-processing and Reuse.pdf | 2024-08-08 10:16 | 1.2M | |
| 7. Solvent and Chemical agent based separation.pdf | 2024-08-08 10:16 | 480K | |
| 6. Separation Sorting and Volume reduction.pdf | 2024-08-08 10:16 | 806K | |
| 5. Collection and Feedback.pdf | 2024-08-08 10:16 | 315K | |
| 4. Types, Forms, and Uses of Flexible plastic packaging.pdf | 2024-08-08 10:16 | 327K | |
| 3. Polymers Used in Flexible packaging.pdf | 2024-08-08 10:16 | 249K | |
| 2. Environmental and socio-economic effects.pdf | 2024-08-08 10:16 | 240K | |
| 1. Flexible plastic packaging and recycling.pdf | 2024-08-08 10:16 | 186K | |