![[ICO]](/icons/blank.gif) | Name | Last modified | Size | Description |
|---|
|
|---|
![[PARENTDIR]](/icons/back.gif) | Parent Directory | | - | |
![[ ]](/icons/layout.gif) | 092209 Beaucage Talk Polyolefin Ca.pdf | 2009-09-22 12:12 | 14M | |
![[ ]](/icons/unknown.gif) | 1sheet.pdb | 2006-01-30 12:45 | 2.6K | |
| 310Helix.PDB | 2006-01-11 10:54 | 19K | |
![[IMG]](/icons/image2.gif) | 50000Gaussian.png | 2006-01-11 10:34 | 61K | |
| AdjacentReentryAFM.pdf | 2006-02-21 20:25 | 181K | |
| AlkaneAFMAdjacentReentry.pdf | 2008-12-01 13:38 | 2.1M | |
![[TXT]](/icons/text.gif) | AminoAcids.html | 2007-09-21 13:50 | 1.6K | |
| Amphiphilic.pdf | 2009-10-09 13:05 | 933K | |
| BCP Modeling.pdf | 2009-10-09 13:05 | 1.5M | |
| BCP Section.pdf | 2009-10-28 13:41 | 573K | |
| BCP_ChamphekarM06.pdf | 2006-03-08 09:58 | 179K | |
| Bassett.html | 2006-02-20 12:57 | 1.5K | |
![[DIR]](/icons/folder.gif) | Bassett/ | 2006-02-20 12:41 | - | |
| Beaucage_Kulkarni_Molecular_Structure_Chapter_040907.pdf | 2008-10-20 07:20 | 4.1M | |
| Beta_strand.gif | 2006-01-30 12:36 | 7.5K | |
| BriberOriginofBanding93.pdf | 2006-02-28 05:27 | 6.6M | |
| Cammarata_Eby_JMR91_stressLam.pdf | 2006-03-08 08:52 | 631K | |
| Chapter1.pdf | 1998-12-30 10:09 | 8.9K | |
| Chapter1html/ | 2005-12-06 07:31 | - | |
| Chapter2.pdf | 1998-12-30 10:14 | 151K | |
| Chapter2html/ | 2005-12-06 07:31 | - | |
| Chapter3.pdf | 1998-12-30 10:06 | 41K | |
| Chapter3html/ | 2005-12-06 07:31 | - | |
| Chapter4.pdf | 1998-12-30 10:20 | 149K | |
| Chapter4html/ | 2005-12-06 07:31 | - | |
| Chapter7 Orientation Swedish.pdf | 2006-02-16 11:21 | 1.6M | |
| Chapter 61 Swedish.pdf | 2006-02-16 11:13 | 2.2M | |
| Chapter 62 Swedish.pdf | 2006-02-16 11:19 | 4.5M | |
| Chapter 63 Swedish.pdf | 2006-02-16 11:18 | 3.6M | |
| Collagen_TIffany.pdf | 2006-03-10 13:50 | 377K | |
| CosmicDust.png | 2006-03-07 08:54 | 80K | |
| CosmicDust2000.pdf | 2006-03-07 09:00 | 70K | |
| CourseSummary.html | 2006-03-10 10:46 | 9.5K | |
| Diffusion Coefficient for Fractal Aggregates.pdf | 2007-11-30 13:44 | 555K | |
| DynamicsIndex.html | 2008-11-14 08:58 | 1.5K | |
| Ehrlich 1995.pdf | 2009-11-16 13:31 | 5.2M | |
| FractalNetworks.pdf | 2005-12-30 09:08 | 95K | |
| FreeEnergyLandscape.pdf | 2006-01-20 11:58 | 1.0M | |
| From Review of paper Bowle_Bruce_E.pdf | 2007-10-09 11:30 | 509K | |
| GeneticCode.html | 2007-09-19 13:03 | 547 | |
| Grades06.png | 2006-03-14 10:40 | 10K | |
| Grades06Adjusted.png | 2006-03-14 10:35 | 10K | |
| Grades2007F.png | 2007-12-10 10:04 | 35K | |
| GradesCME3002011.png | 2012-03-17 21:24 | 119K | |
| HIERARCHICAL_CONSTRUCTION_O.pdf | 2006-02-25 13:11 | 813K | |
| HamadaKinugasaHayashiNakajima1985.pdf | 2008-11-07 13:34 | 597K | |
| HeliciesC.pdf | 2009-10-30 13:18 | 379K | |
| HierarchicalStructureAggregates.pdf | 2007-11-30 13:45 | 2.0M | |
| HierarchyOfAPolymerCoil.html | 2006-02-06 16:33 | 3.9K | |
| HierarchyTable.png | 2007-09-21 10:13 | 31K | |
| Hierarchy_of_Bone_Structure.pdf | 2006-03-08 10:05 | 678K | |
| Ising Chain.pdf | 2009-11-02 13:45 | 326K | |
| KeithPaddenLotzWhittmanChainTilt.pdf | 2006-02-28 05:37 | 8.2M | |
| KeratinTiffany.pdf | 2006-03-10 13:49 | 291K | |
| Kohn PNAS 2004 Scaling of Proteins.pdf | 2007-10-15 13:08 | 323K | |
| LanguageMikeStarr.pdf | 2006-03-11 10:37 | 161K | |
| LiquidCrystal_Hierarchy.pdf | 2006-03-08 16:34 | 316K | |
| Lohse Review 2005 18807217.pdf | 2008-11-14 13:09 | 424K | |
| LotzC.pdf | 2006-02-16 11:05 | 1.2M | |
| MEMS Mixing Phil_Trans_OttiWigg.pdf | 2008-10-17 08:09 | 160K | |
| MeakinVoldSunderlandEdenWittenSanders.pdf | 2012-02-22 13:35 | 658K | |
| Mercaptoethanol.png | 2006-01-21 09:51 | 361 | |
| MorphGrades00.GIF | 2000-06-05 08:43 | 9.3K | |
| MorphSyllabus.html | 2000-03-24 15:14 | 7.0K | |
| MorphSyllabus.pdf | 1998-12-30 11:08 | 11K | |
| Morphology.pdf | 1998-12-30 09:49 | 4.8K | |
| NAlkanesBoilingandMelting.png | 2009-11-06 12:38 | 15K | |
| NSFAerosolPar Report.pdf | 2005-01-17 15:43 | 1.3M | |
| Overview.html | 2007-09-19 10:49 | 3.9K | |
| PandeNature2002.pdf | 2006-01-20 12:02 | 317K | |
| PaulEhrlich.pdf | 2007-11-09 13:47 | 1.1M | |
| PaulEhrlich/ | 2006-02-21 11:35 | - | |
| Persistence/ | 2007-10-12 18:14 | - | |
| Phillips-review-90.pdf | 2006-02-16 07:59 | 4.2M | |
| Phillips/ | 2006-01-30 13:17 | - | |
| Phillips1994.pdf | 2006-02-17 17:04 | 7.5M | |
| PhillipsBoydHelices.html | 2006-01-30 13:16 | 1.7K | |
| Physics of Chromatin Schiessel 2003.pdf | 2009-10-10 09:14 | 961K | |
| Polymer Crystal Hierarchy.htm | 2006-02-17 09:37 | 4.9K | |
| PolymerCrystalfromVirginiaTech.pdf | 2012-03-07 13:43 | 763K | |
| PolymerCrystallizationUnderShear.pdf | 2005-07-05 14:49 | 1.0M | |
| ProteinFolding.html | 2007-09-21 12:12 | 4.7K | |
| ProteinG.png | 2006-01-11 10:32 | 14K | |
| Protein Tensile Measurement.pdf | 2008-10-15 12:16 | 247K | |
| Quardinary Index.html | 2006-01-09 11:39 | 150 | |
| Quaternary Index.html | 2009-10-19 13:50 | 2.6K | |
| Quizzes/ | 2006-03-14 10:05 | - | |
| Quizzes2007Fall/ | 2007-12-10 10:15 | - | |
| Quizzes2008Fall/ | 2008-12-08 13:53 | - | |
| Quizzes2012Winter/ | 2012-03-14 12:06 | - | |
| RNA Links.html | 2007-10-19 15:32 | 479 | |
| RamCriticalReview.pdf | 2008-10-27 13:27 | 1.5M | |
| RateLimitingKinetics.htm | 2005-04-23 09:45 | 6.2K | |
| Rate Limiting Step for Crystallization.doc | 2005-04-23 09:43 | 26K | |
| RenekerAdjacentReentry.png | 2006-02-21 20:35 | 1.2M | |
| RenekerKingofAFM.pdf | 2006-02-21 20:30 | 4.4M | |
| RyanBreese_Paper_for_Morph_class.pdf | 2006-02-27 12:35 | 851K | |
| Secondary Structure.html | 2006-01-13 13:23 | 3.1K | |
| SimulatedFractalTree.png | 2005-12-30 08:44 | 27K | |
| SingleCrystalPENanoparticlesnl070859f.pdf | 2011-02-03 21:14 | 261K | |
| Slides/ | 2012-03-05 14:39 | - | |
| Sperling.html | 2006-02-15 13:24 | 770 | |
| Sperling/ | 2006-02-15 13:22 | - | |
| Spider_capture_silk.pdf | 2006-02-09 13:22 | 178K | |
| StroblPlotsThePhysicsofPolymers.pdf | 2008-10-29 09:14 | 895K | |
| SukumaranScience.pdf | 2008-10-27 13:22 | 490K | |
| Tertiary Index.html | 2007-10-05 13:25 | 2.7K | |
| Turns.html | 2006-01-11 11:38 | 2.6K | |
| Turns/ | 2006-01-11 11:23 | - | |
| Urea.png | 2006-01-21 09:52 | 863 | |
| WhiteTreesBW.png | 2005-12-30 08:37 | 649K | |
| alphahelix.pdb | 2006-01-30 12:50 | 3.3K | |
| annurev.biophys.36.040306.132655.pdf | 2007-10-15 07:08 | 588K | |
| apmmi04.gif | 2006-02-17 09:13 | 18K | |
| construction_with_macromole.pdf | 2006-02-04 09:32 | 1.5M | |
| interstellardust.gif | 2006-03-07 09:06 | 44K | |
| persistencePhilosophy.htm | 2006-01-30 12:28 | 1.7K | |
| yuri lyubchenko speaker2.pdf | 2009-10-14 13:10 | 105K | |
|
|---|
