![[ICO]](/icons/blank.gif) | Name | Last modified | Size | Description |
|---|
|
|---|
![[PARENTDIR]](/icons/back.gif) | Parent Directory | | - | |
![[ ]](/icons/layout.gif) | the collected papers of Peter J. W. Debye, pgs 500-513; 547-558 copy.pdf | 2014-10-20 11:03 | 3.1M | |
| the collected papers of Peter J. W. Debye, pgs 500-513; 547-558.pdf | 2009-02-12 10:17 | 751K | |
| the_SANS_toolbox.pdf | 2008-03-04 08:20 | 5.9M | |
![[IMG]](/icons/image2.gif) | space-junk.png | 2007-04-14 08:11 | 76K | |
| redbook.pdf | 2005-05-17 11:26 | 2.1M | |
| polyelectrolytepersistenceMM38-9304.pdf | 2012-10-01 10:16 | 134K | |
| physik_dot_uni_osnabrueck_dot_de.pdf | 2006-05-25 08:57 | 304K | |
| maChainStiffnessMonTeCarloPersisDef2005.pdf | 2005-10-09 13:50 | 529K | |
| fbioe-10-916354.pdf | 2025-03-12 09:55 | 3.9M | |
| eins_brownian.pdf | 2007-03-31 12:23 | 340K | |
![[ ]](/icons/unknown.gif) | chiExVolExVol1b5VStemp.pxp | 2005-04-29 10:39 | 19K | |
| ZimmPlot.png | 2009-03-06 10:13 | 242K | |
![[DIR]](/icons/folder.gif) | ZimmModelPaddingAward/ | 2017-02-20 09:19 | - | |
| ZimmIASLightScat.pdf | 2005-05-10 17:23 | 199K | |
| ZimmEquationandRPAFunction.pdf | 2009-03-07 17:22 | 595K | |
| Yethiraj bottle brush polymers 1.2374884.pdf | 2022-01-30 23:52 | 522K | |
| Yale Confinemen Blobs handout3.pdf | 2016-03-18 10:38 | 170K | |
| WittenPaperPackingLength.pdf | 2013-09-20 11:01 | 2.0M | |
| WittenPaper.pdf | 2004-04-06 18:31 | 1.0M | |
| WhatisaCriticalReview.pdf | 2002-03-29 12:19 | 7.0K | |
![[TXT]](/icons/text.gif) | WhatisaCriticalReview.html | 2002-03-29 12:19 | 15K | |
| Volkenstein on Flory II Journal of Polymer Science Part A-2 Polymer Physics - January 1970 - Volkenstein - Statistical mechanics of chain.pdf | 2025-02-03 10:01 | 134K | |
| VirialForGas395chap6.pdf | 2005-04-28 18:05 | 43K | |
| Unidad Richter Fetters 2015.pdf | 2016-02-11 17:11 | 950K | |
| UGGrades.GIF | 2001-06-08 16:14 | 4.2K | |
| TwoPointMicrorhelogy.pdf | 2025-03-12 09:55 | 1.0M | |
| TopologyandRheologyScience2003.pdf | 2006-06-22 09:49 | 0 | |
| Theta Temperature Plot jcp_105_802.pdf | 2012-04-11 20:32 | 166K | |
| Thermodynamics.pdf | 2006-04-10 06:39 | 14K | |
| Thermal Blob_ The Why and What of it.pdf | 2010-03-03 12:40 | 23K | |
| ThermalBlob.pdf | 2001-04-20 17:16 | 16K | |
| ThermalBlob.html | 2001-04-20 17:16 | 8.3K | |
| Teraoka Polymer Solutions An Introduction Teraoka.pdf | 2012-09-19 15:14 | 3.1M | |
| TensileBlob.pdf | 2004-04-30 15:37 | 8.8K | |
| Syllabus.pdf | 2004-03-27 11:51 | 17K | |
| Syllabus.html | 2012-08-27 09:34 | 9.1K | |
| Sukumaran2004Science.pdf | 2007-05-25 13:47 | 433K | |
| Sukumaran.pdf | 2004-04-30 15:37 | 195K | |
| Structure formation at surfaces Pincus.pdf | 2017-02-11 09:07 | 1.2M | |
| Strobl Universial Osmotic Plot.png | 2006-05-08 14:33 | 972K | |
| Strobl Osmotic Plot.png | 2006-05-08 14:36 | 746K | |
| Strobl2DynamicParameters.pdf | 2006-05-09 09:19 | 1.2M | |
| Stockmayer1971ShapeJChemPhys_54_2756.pdf | 2007-04-13 08:55 | 158K | |
| Space-Junk.html | 2007-04-14 08:23 | 1.4K | |
| Sonja Krause from DRPaulPolymerBlends.pdf | 2009-03-02 09:59 | 2.7M | |
| Solc Shape of Random Walk 1971 JChemPhys_55_335.pdf | 2007-04-13 09:06 | 762K | |
| Slides/ | 2025-04-10 10:20 | - | |
| Simultatoin Results Circa 2010 PhysRevLett.104.055702.pdf | 2017-02-14 21:35 | 197K | |
| SheffieldSection5.pdf | 2005-05-16 14:22 | 1.6M | |
| SheffieldSection1.pdf | 2005-05-16 14:17 | 51K | |
| SheffieldNotesSection4.pdf | 2005-05-16 14:20 | 166K | |
| SheffieldNotesSection3.pdf | 2005-05-16 14:19 | 311K | |
| SheffieldNotesSection2.pdf | 2005-05-16 14:14 | 513K | |
| Schaefer and Han 1985 DLS in Polymers.pdf | 2016-12-01 09:54 | 4.4M | |
| Sanat Kumar/ | 2025-04-15 14:20 | - | |
| S02Grades.GIF | 2002-06-08 14:30 | 23K | |
| RubberElasticityhtml/ | 2001-05-14 16:44 | - | |
| RubberElasticity.pdf | 2001-05-30 13:36 | 34K | |
| Rouse Ring Papers/ | 2016-04-21 22:01 | - | |
| Rouse Paper 2014 b.pdf | 2014-12-01 14:00 | 2.7M | |
| Rotational Diffusion Coefficient for Persistence Length 360200709_ftp.pdf | 2013-09-06 10:49 | 2.1M | |
| Richter Chain Conformations C inf ma201288a.pdf | 2013-09-16 10:37 | 1.1M | |
| RgbyRhRatioBurchardma60077a045.pdf | 2013-11-06 10:22 | 884K | |
| RgbyRhPNIPAAMma971873p.pdf | 2013-11-06 10:22 | 76K | |
| RgbyRhCoiltoGlobulema8019128.pdf | 2013-11-06 10:22 | 118K | |
| RgandRhvsTemp.png | 2005-04-27 10:46 | 112K | |
| RgandRHHan1979ma60068a022.pdf | 2013-11-06 10:22 | 589K | |
| ResultsFHGT.png | 2005-05-25 09:55 | 26K | |
| RequiredCourses.htm | 2006-03-27 14:14 | 3.2K | |
| Ref for 0p588 PhysRevB.21.3976.pdf | 2017-02-14 06:32 | 1.0M | |
| RatevsQSpinodal.png | 2005-05-25 10:22 | 21K | |
| RadiusofGyrationHomogeneousBodies.png | 2007-04-20 14:02 | 258K | |
| RadiusofGyration.pdf | 2005-04-13 10:30 | 20K | |
| RadiusofGyration.doc | 2005-04-13 10:30 | 24K | |
| RPANotes03.pdf | 2003-05-22 16:24 | 20K | |
| RH from NMR bogus paper 1999 bi991765q.pdf | 2016-03-11 09:18 | 89K | |
| Quizzes Homework 10/ | 2010-03-20 11:21 | - | |
| Quizzes 2019/ | 2019-04-26 10:41 | - | |
| Quizzes 2017/ | 2017-04-23 20:34 | - | |
| Quizzes 2016 Spring/ | 2016-04-23 11:41 | - | |
| Quizzes 2014/ | 2014-12-01 11:14 | - | |
| Quizzes2013/ | 2013-11-25 14:28 | - | |
| Quizzes2012/ | 2013-08-25 20:11 | - | |
| Quizzes2009/ | 2009-03-22 17:07 | - | |
| Quizzes08/ | 2009-03-22 17:11 | - | |
| Quizzes07/ | 2007-06-04 17:16 | - | |
| Quizzes06/ | 2006-06-08 14:37 | - | |
| Quizzes05/ | 2009-03-22 17:15 | - | |
| Quizzes04/ | 2004-06-08 14:19 | - | |
| Quizzes03/ | 2003-06-09 10:34 | - | |
| Quizs2001PDF/ | 2002-05-19 14:11 | - | |
| Quizes 2012F Semester/ | 2013-08-25 20:11 | - | |
| Quizes2002PDF/ | 2002-06-10 12:32 | - | |
| Quiz 5 Polymer Properties.pdf | 2017-02-17 09:10 | 288K | |
| QuestionFrom Class.pdf | 2006-04-07 16:54 | 52K | |
| Protein Glass Transition Review.pdf | 2006-06-05 08:41 | 229K | |
| Poster for Class New.png | 2013-08-22 13:59 | 489K | |
| Polymer Trumpeting at surface.pdf | 2016-03-18 10:38 | 1.6M | |
| Polymer Textbook.pdf | 2013-09-20 11:01 | 3.1M | |
| Polymer Solutions Textbook BPI 2002.pdf | 2016-03-09 10:02 | 3.1M | |
| Polymer Physics Quzzes 2021/ | 2021-04-11 22:17 | - | |
| Polymer Physics Quizzes 2022/ | 2023-01-10 22:01 | - | |
| Polymer Physics Homework 2025/ | 2025-04-23 00:27 | - | |
| Polymer Physics Homework 2024/ | 2024-04-18 19:18 | - | |
| Polymer Physics Homework 2023/ | 2023-04-18 22:58 | - | |
| Polymer Brushes UCONN lec19.pdf | 2016-03-18 10:38 | 263K | |
| PolymerBlends.pdf | 2001-05-03 18:04 | 9.9K | |
| PolyelectrolyteChainPersistence China.pdf | 2013-09-23 11:02 | 2.3M | |
| Plagiarism in Scientific Writing.pdf | 2014-09-14 14:11 | 73K | |
| Pincus76.pdf | 2004-04-30 15:37 | 319K | |
| Physics Quizzes 2020/ | 2020-04-26 15:15 | - | |
| Phase_Diagrams.pdf | 2009-03-02 09:37 | 231K | |
| Persistence and SCB Experiments ma049485s.pdf | 2007-04-26 17:41 | 125K | |
| Persistence_in_Rotaxanes_2014_Sommer.pdf | 2014-09-21 12:16 | 2.3M | |
| PersistenceLengthhtml/ | 2002-04-06 10:52 | - | |
| Persistence Length from Spring Constant 1974 360130115_ftp.pdf | 2013-09-06 10:49 | 464K | |
| PersistenceLength.pdf | 2002-04-06 10:52 | 115K | |
| PedersonSommer2882_10993675_Chapter_9.pdf | 2017-03-01 09:58 | 377K | |
| Pedersen_Jan_Skov_PSConcBlob.pdf | 2017-03-01 09:26 | 233K | |
| Parag discssion onScreening.pdf | 2004-05-10 13:22 | 8.3K | |
| PROPERTIESOldVideos.html | 2025-01-18 11:53 | 11K | |
| PNIPAM Phase Behavior 2015 AngChemi.pdf | 2016-03-31 21:15 | 11M | |
| OsmoticPresPlots.html | 2006-05-08 14:37 | 376 | |
| OsmoticPFromKTGshtml/ | 2002-04-23 11:21 | - | |
| OsmoticPFromKTGs.pdf | 2002-04-23 11:20 | 134K | |
| OptionalProjects/ | 2020-02-23 08:45 | - | |
| OldHomework_Quizes_PolymerProperties.html | 2025-01-18 11:56 | 99K | |
| OldClassNotes.html | 2024-01-07 16:22 | 25K | |
| NiceDescriptionofPersistence.pdf | 2005-10-22 13:35 | 534K | |
| N1to10000_Chi2p5_N1_Chi2p25vsphi.pdf | 2009-02-23 10:10 | 213K | |
| Murnen Soft Matter 2013 c2sm26849c.pdf | 2013-09-27 11:57 | 539K | |
| Mug_and_Torus_morph.gif | 2007-04-13 16:26 | 497K | |
| More_UG_notes.pdf | 2001-04-13 15:15 | 3.0K | |
| MW20and20branchingUCLAche212.pdf | 2005-05-06 08:36 | 133K | |
| MODULUs from DWS mason-josa97.pdf | 2012-11-05 10:19 | 271K | |
| Lohse Review 2005 18807217.pdf | 2013-09-22 21:23 | 454K | |
| Lin_ma00178a024_PackingLength.pdf | 2013-09-22 21:23 | 581K | |
| LiandWitten1995FluctuationsandpersistencePolyelectrolytesma00121a031.pdf | 2013-11-08 11:48 | 857K | |
| Larson Review of Tube Model for Rheology.pdf | 2017-02-03 07:04 | 289K | |
| Kirkwood 1951 RH calculation 120120102_ftp.pdf | 2013-10-25 10:34 | 632K | |
| Kirkwood-1954-Journal_of_Polymer_Science.pdf | 2020-03-11 09:58 | 632K | |
| Karasz 2003 coil globule review.pdf | 2017-02-21 21:35 | 254K | |
| Julia Higgins Life Story annurev-chembioeng-080615-034429.pdf | 2017-02-03 07:52 | 2.2M | |
| Hyperbranched Polymers Review 2009.pdf | 2013-09-16 10:37 | 2.0M | |
| HydrodyamicRadius.pdf | 2003-04-16 09:20 | 6.0K | |
| HomeworkGroups2023.jpg | 2023-01-24 09:33 | 114K | |
| HiemenzRajagopalanDLS.pdf | 2009-01-26 10:13 | 426K | |
| HashimotoPaperSpin.pdf | 2012-05-24 11:00 | 956K | |
![[ ]](/icons/compressed.gif) | GraphClick.app.zip | 2013-11-15 07:27 | 2.9M | |
| Granick confined fluids under shear.pdf | 2012-09-05 10:48 | 627K | |
| GradesW09.png | 2009-03-23 16:35 | 41K | |
| GradesW08.png | 2008-03-20 21:23 | 52K | |
| GradesS06.png | 2006-06-09 17:33 | 13K | |
| Grades2017Spring.png | 2017-04-23 20:50 | 122K | |
| Grades2016Spring.png | 2016-04-23 11:29 | 126K | |
| Grades2014.png | 2014-12-01 18:30 | 152K | |
| Grades2013.png | 2013-12-05 11:13 | 226K | |
| Grades2012.png | 2013-01-27 17:17 | 90K | |
| Grades07.png | 2007-06-04 17:14 | 34K | |
| Grades04.GIF | 2004-06-07 14:46 | 150K | |
| Grades03.GIF | 2003-06-09 09:58 | 28K | |
| Grades.GIF | 2001-06-08 16:22 | 8.6K | |
| Gel dynamics papers for quiz 12/ | 2016-04-14 21:02 | - | |
| GaussianProbabilityFunctionforEnd.pdf | 2009-01-07 10:25 | 435K | |
| GaussianPlots.png | 2005-03-30 10:10 | 9.9K | |
| GaussianPlot.htm | 2005-03-30 10:10 | 193 | |
| GaussianIntegrals.png | 2010-01-06 17:41 | 1.5M | |
| Gaussi1.gif | 2005-03-30 10:10 | 12K | |
| FrenchPolymSolnslecture7.ppt | 2005-05-11 08:20 | 281K | |
| FractalAggregateMechanics.doc | 2004-04-06 18:32 | 151K | |
| Force Extension Polyelectrolyte 2017.pdf | 2017-02-11 08:41 | 1.0M | |
| Flory page 111 equation.pdf | 2010-02-04 23:55 | 152K | |
| FloryRehnerTheoryFromFloryI.pdf | 2006-04-05 11:07 | 659K | |
| FloryII.Persistence.pdf | 2006-04-10 12:46 | 543K | |
| FloryHugginsHelmholtzperktperlatticesite.pxp | 2006-05-08 15:50 | 23K | |
| FloryHugginsEquation.pdf | 2009-02-26 10:20 | 141K | |
| Flory Biography Brief until Cornell 9783662435359-c2.pdf | 2019-02-21 19:19 | 611K | |
| Farnoux Cross over in polymer solutionsajp-jphys_1978_39_1_77_0.pdf | 2013-11-15 07:27 | 1.3M | |
| FLoryHugginsPlots/ | 2008-03-05 05:52 | - | |
| FH_GibbsThompson.pxp | 2005-05-25 10:22 | 1.3M | |
| ExtensionalFlowcevsc*.pdf | 2017-02-17 09:16 | 1.2M | |
| Example_criticalreview.doc | 2005-06-08 15:10 | 28K | |
| Entanglement vs overlap concentration SolutionsReviewResubmit.pdf | 2016-10-01 21:04 | 1.1M | |
| Electrostatic Persistence Length Overview Dobrynin.pdf | 2013-09-27 11:50 | 231K | |
| DumbellDNA Nature1997.pdf | 2007-05-25 13:32 | 270K | |
| DresdenRgbyRh4659_ftp.pdf | 2013-11-06 10:22 | 432K | |
| Derivation/ | 2006-04-03 17:14 | - | |
| DegreeofBranchingFrey010480105_ftp.pdf | 2013-11-08 11:48 | 617K | |
| DegennesCstarTheorem.pdf | 2006-04-05 13:12 | 556K | |
| Debye 1946 cited by Rouse 1.1724075.pdf | 2023-03-06 12:21 | 888K | |
| Daoud Cotton Model.pdf | 2016-03-17 20:56 | 1.7M | |
| DWS.weitz.physicascripta.1993.pdf | 2012-11-05 10:19 | 1.5M | |
| CriticalReview.pdf | 2001-04-06 08:26 | 3.9K | |
| CourseEvaluations2013Fall.pdf | 2014-10-21 16:13 | 73K | |
| Connolly Milian and DublinMA2005.pdf | 2006-03-29 12:48 | 534K | |
| Collig.pdf | 2005-05-10 17:13 | 179K | |
| Colby c* vs ce polyelectrolytes Review.pdf | 2017-02-17 09:16 | 854K | |
| Coil to Globule Transition.pdf | 2010-03-05 10:45 | 5.1M | |
| CoilToGlobulePNIPAM1998LS.pdf | 2012-10-13 18:29 | 132K | |
| ClassList2010.png | 2010-03-20 11:35 | 65K | |
| ChiExVolExVolP1b5vsTemp.htm | 2005-04-27 10:53 | 449 | |
| ChiExVolExVol1b5VStemp.png | 2005-04-29 10:37 | 26K | |
| CahnHilliardvsGibbsThompson.htm | 2005-05-27 11:52 | 2.3K | |
| BottleBrushPersistenceJChemPhys_120_6257.pdf | 2022-01-30 23:56 | 412K | |
| Books/ | 2025-01-14 22:49 | - | |
| Book.pdf | 2013-10-16 21:08 | 27M | |
| Birshtein1991ColitoGlobuleTransition.pdf | 2012-10-15 13:54 | 775K | |
| BinderReviewPersistence2013 1303.2543v1.pdf | 2013-09-06 10:49 | 721K | |
| Bicerano_Douglas_Brune_JMacromolSciRevMacromolChemPhys_39_561_1999.pdf | 2012-10-30 21:54 | 556K | |
| Benoit Higgins Rg things star etc.pdf | 2010-02-18 12:51 | 323K | |
| Beaucage Paper Revised.pdf | 2008-01-20 23:24 | 1.0M | |
| Beaucage2.pdf | 2007-04-23 14:16 | 1.3M | |
| ArunJChemPhys_125_204901.pdf | 2008-01-25 08:56 | 342K | |
| Alexei R. Khokhlov Moscow State University lecture5 coil globule transition.pdf | 2017-02-21 21:35 | 2.8M | |
| AIClassSummary/ | 2025-04-04 12:19 | - | |
| 120615NanoPowerAfricaUSAIDBeaucageTalk.ppt | 2012-07-16 15:26 | 44M | |
| 2012FGrades.png | 2012-09-24 16:39 | 87K | |
| 2008HongKongPaperonHysterisisinCoiltoGlobuleTransition.pdf | 2012-10-15 13:54 | 409K | |
|
|---|
